For research use only. Not for therapeutic Use.
Fasnall(Cat No.:I011903)is a small molecule inhibitor that specifically targets fatty acid synthase (FASN), an enzyme crucial for the synthesis of fatty acids in cells. By inhibiting FASN, Fasnall disrupts lipid metabolism, which can be beneficial in cancer therapy, as rapidly growing tumor cells often rely on fatty acid synthesis for their energy and growth. Fasnall has shown promise in preclinical studies for its ability to reduce tumor growth and sensitize cancer cells to other treatments. Ongoing research aims to explore its potential in cancer treatment and other metabolic disorders.
CAS Number | 929978-58-5 |
Synonyms | N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
Molecular Formula | C19H22N4S |
Purity | ≥95% |
IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-5,6-dimethylthieno[2,3-d]pyrimidin-4-amine |
InChI | InChI=1S/C19H22N4S/c1-13-14(2)24-19-17(13)18(20-12-21-19)22-16-8-9-23(11-16)10-15-6-4-3-5-7-15/h3-7,12,16H,8-11H2,1-2H3,(H,20,21,22) |
InChIKey | VSXRMURGJRAOCU-UHFFFAOYSA-N |
SMILES | CC1=C(SC2=NC=NC(=C12)NC3CCN(C3)CC4=CC=CC=C4)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |