For research use only. Not for therapeutic Use.
Farnesene(Cat No.:I043620)is a mixture of isomers, primarily composed of sesquiterpenes, found naturally in various plants, including apples, hops, and mint. It plays a role in plant defense by acting as an insect repellent or attractant. Farnesene is widely used in the fragrance and flavor industries due to its pleasant, citrusy aroma. In addition, its potential applications extend to the pharmaceutical and agricultural sectors, where it may have antimicrobial, anti-inflammatory, and antioxidant properties. The compound is also being explored for its potential in biofuels and sustainable chemical production.
CAS Number | 125037-13-0 |
Synonyms | (3E,6E)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
Molecular Formula | C15H24 |
Purity | ≥95% |
IUPAC Name | 3,7,11-trimethyldodeca-1,3,6,10-tetraene |
InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3 |
InChIKey | CXENHBSYCFFKJS-UHFFFAOYSA-N |
SMILES | CC(=CCCC(=CCC=C(C)C=C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |