For research use only. Not for therapeutic Use.
Falimint（Cat No.:M164684）is a therapeutic compound commonly used as a throat lozenge to provide relief from sore throats and reduce cough symptoms. It works by soothing the throat and providing a cooling, refreshing sensation. The active ingredient, typically a menthol derivative or similar compound, helps to alleviate irritation and inflammation in the throat, making it ideal for symptomatic treatment of conditions like common colds or respiratory infections. Falimint is also known for its mild anesthetic effect, reducing the discomfort associated with sore throat and promoting easier swallowing.
| CAS Number | 553-20-8 |
| Synonyms | N-(5-nitro-2-propoxyphenyl)acetamide |
| Molecular Formula | C11H14N2O4 |
| Purity | ≥95% |
| IUPAC Name | N-(5-nitro-2-propoxyphenyl)acetamide |
| InChI | InChI=1S/C11H14N2O4/c1-3-6-17-11-5-4-9(13(15)16)7-10(11)12-8(2)14/h4-5,7H,3,6H2,1-2H3,(H,12,14) |
| InChIKey | OPTZOXDYEFIPJZ-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
