For research use only. Not for therapeutic Use.
FAK-IN-7（Cat No.:I042885）is an experimental small molecule inhibitor designed to target focal adhesion kinase (FAK), a protein involved in cell adhesion, migration, and survival. FAK plays a critical role in cancer progression, especially in tumor metastasis and the tumor microenvironment. By inhibiting FAK, FAO-IN-7 aims to disrupt these processes, preventing cancer cells from spreading and improving the effectiveness of existing cancer therapies. It is being studied for its potential in treating various cancers, including breast and ovarian cancer, by reducing tumor growth and enhancing the immune system’s ability to target cancer cells.
| CAS Number | 19948-85-7 |
| Synonyms | N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| Molecular Formula | C16H13N3OS |
| Purity | ≥95% |
| IUPAC Name | N-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| InChI | InChI=1S/C16H13N3OS/c1-11-7-9-13(10-8-11)15-18-19-16(21-15)17-14(20)12-5-3-2-4-6-12/h2-10H,1H3,(H,17,19,20) |
| InChIKey | SIHYHKOFZPWMHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN=C(S2)NC(=O)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
