For research use only. Not for therapeutic Use.
Ezetimibe-d4 is a deuterated analog of the cholesterol-lowering drug ezetimibe, featuring four deuterium atoms for enhanced stability and precision in research. This isotopically labeled compound is crucial for studying the pharmacokinetics, metabolism, and mechanism of action of ezetimibe in reducing cholesterol levels. Ezetimibe-d4 ensures reliable and consistent results in advanced pharmaceutical research and clinical studies, making it an essential tool for scientists and healthcare professionals developing new lipid-lowering therapies. Ideal for use in mass spectrometry and other analytical techniques, it supports accurate tracking in biological systems.
| CAS Number | 1093659-90-5 |
| Molecular Formula | C24H17D4F2NO3 |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (3R,4S)-3-[(3S)-3-(4-fluorophenyl)-3-hydroxypropyl]-4-(4-hydroxyphenyl)-1-(2,3,5,6-tetradeuterio-4-fluorophenyl)azetidin-2-one |
| InChI | InChI=1S/C24H21F2NO3/c25-17-5-1-15(2-6-17)22(29)14-13-21-23(16-3-11-20(28)12-4-16)27(24(21)30)19-9-7-18(26)8-10-19/h1-12,21-23,28-29H,13-14H2/t21-,22+,23-/m1/s1/i7D,8D,9D,10D |
| InChIKey | OLNTVTPDXPETLC-ARVCERDTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N2[C@@H]([C@H](C2=O)CC[C@@H](C3=CC=C(C=C3)F)O)C4=CC=C(C=C4)O)[2H])[2H])F)[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |