For research use only. Not for therapeutic Use.
Exo-5,6-Oxi-2,3-Norbornanedicarboxamide is a specialized chemical compound used in organic synthesis and material science. Its unique bicyclic structure makes it valuable in the development of advanced polymers and pharmaceuticals. Known for its stability and reactivity, it facilitates the creation of complex molecular architectures, playing a crucial role in cutting-edge research and industrial applications.
| CAS Number | 85026-47-7 |
| Synonyms | (1aR,2R,2aS,5aR,6S,6aS)-Tetrahydro-1aH-2,6-methanooxireno[2,3-f]isoindole-3,5(4H,5aH)-dione |
| Molecular Formula | C9H9NO3 |
| Purity | ≥95% |
| Storage | -80°C |
| InChI | InChI=1S/C9H9NO3/c11-8-4-2-1-3(7-6(2)13-7)5(4)9(12)10-8/h2-7H,1H2,(H,10,11,12)/t2-,3+,4+,5-,6-,7+ |
| InChIKey | UJXPPCDJYRWSLC-GIDHVPLMSA-N |
| SMILES | C1C2C3C(C1C4C2O4)C(=O)NC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |