For research use only. Not for therapeutic Use.
Evolitrine（Cat No.:I015411）is a naturally occurring alkaloid primarily isolated from species of Erythrina plants. It belongs to the erythrinan alkaloid family and is recognized for its complex heterocyclic structure and bioactive properties. Studies indicate that evolitrine exhibits potential pharmacological effects, including antimicrobial, anti-inflammatory, and neuroactive activities, making it of interest in natural product and medicinal chemistry research. As a plant-derived compound, it is also investigated for its ecological role and potential therapeutic applications. Evolitrine serves as a useful reference material in phytochemistry, drug discovery, and structure–activity relationship studies.
| CAS Number | 523-66-0 |
| Synonyms | 4,7-dimethoxyfuro[2,3-b]quinoline |
| Molecular Formula | C13H11NO3 |
| Purity | ≥95% |
| IUPAC Name | 4,7-dimethoxyfuro[2,3-b]quinoline |
| InChI | InChI=1S/C13H11NO3/c1-15-8-3-4-9-11(7-8)14-13-10(5-6-17-13)12(9)16-2/h3-7H,1-2H3 |
| InChIKey | TWGHMXOYRUTQOL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C3C=COC3=N2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
