For research use only. Not for therapeutic Use.
Euxanthone(CAT: R007460) is a naturally occurring xanthone derivative characterized by a tricyclic aromatic structure with hydroxyl and methoxy substituents. Isolated from various plant sources, it exhibits a wide range of biological activities, including antioxidant, anti-inflammatory, anticancer, and antimicrobial properties. Euxanthone’s planar, conjugated structure enables DNA intercalation and enzyme interaction, making it a valuable lead compound in drug discovery and pharmacological research. It is also studied for its potential effects on signaling pathways and cellular oxidative stress. Due to its rich pharmacophore profile, euxanthone is widely used in natural product chemistry, SAR studies, and bioassay-guided screening.
| CAS Number | 529-61-3 |
| Molecular Formula | C13H8O4 |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | -20°C |
| IUPAC Name | 1,7-dihydroxyxanthen-9-one |
| InChI | InChI=1S/C13H8O4/c14-7-4-5-10-8(6-7)13(16)12-9(15)2-1-3-11(12)17-10/h1-6,14-15H |
| InChIKey | KDXFPEKLLFWHMN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(O2)C=CC(=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
