For research use only. Not for therapeutic Use.
Euphorbetin（Cat No.:I044884）is a naturally occurring dimeric coumarin compound isolated from plants of the Euphorbia genus. Structurally, it consists of two coumarin units linked via a carbon–carbon bond, forming a unique dimer with enhanced biological properties. Euphorbetin is known for its potent antioxidant, anti-inflammatory, and cytotoxic activities. It has shown promising effects in inhibiting cancer cell proliferation and modulating oxidative stress pathways. Due to its distinct chemical structure and bioactivity, euphorbetin is of interest in natural product research for potential applications in cancer therapy, inflammation-related disorders, and pharmaceutical development.
| CAS Number | 35897-99-5 |
| Synonyms | 5-(6,7-dihydroxy-2-oxochromen-5-yl)-6,7-dihydroxychromen-2-one |
| Molecular Formula | C18H10O8 |
| Purity | ≥95% |
| IUPAC Name | 5-(6,7-dihydroxy-2-oxochromen-5-yl)-6,7-dihydroxychromen-2-one |
| InChI | InChI=1S/C18H10O8/c19-9-5-11-7(1-3-13(21)25-11)15(17(9)23)16-8-2-4-14(22)26-12(8)6-10(20)18(16)24/h1-6,19-20,23-24H |
| InChIKey | MFAPGDLENWJYSK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C1C(=C(C(=C2)O)O)C3=C(C(=CC4=C3C=CC(=O)O4)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
