For research use only. Not for therapeutic Use.
Euparin（Cat No.:R064707）is a naturally occurring benzofuran derivative isolated from plants such as Eupatorium species, particularly Eupatorium inulaefolium. It exhibits notable antimicrobial, antifungal, and insecticidal properties, making it of interest in both pharmacological and agricultural research. Structurally, euparin features a benzofuran core with reactive functional groups that contribute to its bioactivity. It is studied for its ability to disrupt microbial cell membranes and inhibit fungal growth. As a plant-derived compound with broad-spectrum biological effects, euparin shows promise in the development of natural pesticides and alternative therapeutic agents.
| CAS Number | 532-48-9 |
| Synonyms | 1-(6-hydroxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone |
| Molecular Formula | C13H12O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(6-hydroxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone |
| InChI | InChI=1S/C13H12O3/c1-7(2)12-5-9-4-10(8(3)14)11(15)6-13(9)16-12/h4-6,15H,1H2,2-3H3 |
| InChIKey | OPUFDNZTKHPZHM-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC2=CC(=C(C=C2O1)O)C(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
