For research use only. Not for therapeutic Use.
Eugenol-d3(Cat No.:R017635), is a deuterium-labeled derivative of eugenol. Deuterium is a stable isotope of hydrogen, and in eugenol-d3, three hydrogen atoms have been replaced with deuterium atoms. Eugenol is a natural compound found in essential oils derived from plants like clove, basil, and cinnamon. Eugenol-d3 is commonly used as an internal standard in analytical chemistry and research, especially in studies involving the quantification and identification of eugenol in various samples using techniques like mass spectrometry or nuclear magnetic resonance (NMR) spectroscopy.
CAS Number | 1335401-17-6 |
Synonyms | 2-Methoxy-4-(2-propen-1-yl)phenol-d3; 2-Methoxy-4-(2-propenyl)phenol-d3; 4-Allyl-2-methoxyphenol-d3; 1-Allyl-4-hydroxy-3-methoxybenzene-d3; 2-Hydroxy-5-allylanisole-d3; 2-Methoxy-1-hydroxy-4-allylbenzene-d3; 2-Methoxy-4-(2-propenyl)phenol-d3; 2-Metho |
Molecular Formula | C10H12O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | -20°C |
IUPAC Name | 4-prop-2-enyl-2-(trideuteriomethoxy)phenol |
InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3/i2D3 |
InChIKey | RRAFCDWBNXTKKO-BMSJAHLVSA-N |
SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CC=C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |