For research use only. Not for therapeutic Use.
Eugenin(CAT: I018761) is a chromone compound isolated from Peucedanum japonicum, known for its potent antiplatelet aggregation activity. By inhibiting platelet aggregation, Eugenin shows potential in preventing thrombus formation, making it a valuable candidate for cardiovascular and hematological research. Its natural origin and bioactivity position it as a promising agent for exploring alternative therapies in conditions like thrombosis and other platelet aggregation-related disorders. Eugenin is also significant in natural product and pharmacological studies, where it serves as a lead compound for developing novel anticoagulant or antithrombotic agents.
| CAS Number | 480-34-2 |
| Molecular Formula | C₁₁H₁₀O₄ |
| Purity | ≥95% |
| Target | Plants |
| IUPAC Name | 5-hydroxy-7-methoxy-2-methylchromen-4-one |
| InChI | InChI=1S/C11H10O4/c1-6-3-8(12)11-9(13)4-7(14-2)5-10(11)15-6/h3-5,13H,1-2H3 |
| InChIKey | SUTUBQHKZRNZRA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C=C(C=C2O1)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |