For research use only. Not for therapeutic Use.
ETZ（Cat No.:I044019）is a small molecule compound under investigation for its potential therapeutic applications, particularly in cancer research. It functions as an inhibitor of specific proteins or enzymes involved in tumor growth, metastasis, and cell survival. By targeting key signaling pathways, ETZ aims to disrupt cancer cell proliferation and enhance the effectiveness of existing treatments. The compound is being studied for its potential to overcome resistance mechanisms in cancers, such as non-small cell lung cancer (NSCLC) and other malignancies. ETZ’s unique mechanism of action makes it a promising candidate for targeted cancer therapies.
| CAS Number | 2989379-61-3 |
| Synonyms | 2-[4-[[4-(2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-yl)oxy-4-oxobutanoyl]oxymethyl]triazol-1-yl]acetic acid |
| Molecular Formula | C34H28N6O6 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[[4-(2-benzyl-6,8-diphenylimidazo[1,2-a]pyrazin-3-yl)oxy-4-oxobutanoyl]oxymethyl]triazol-1-yl]acetic acid |
| InChI | InChI=1S/C34H28N6O6/c41-29(42)21-39-19-26(37-38-39)22-45-30(43)16-17-31(44)46-34-27(18-23-10-4-1-5-11-23)36-33-32(25-14-8-3-9-15-25)35-28(20-40(33)34)24-12-6-2-7-13-24/h1-15,19-20H,16-18,21-22H2,(H,41,42) |
| InChIKey | IDKRPNFSPHTVBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(N3C=C(N=C(C3=N2)C4=CC=CC=C4)C5=CC=CC=C5)OC(=O)CCC(=O)OCC6=CN(N=N6)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
