For research use only. Not for therapeutic Use.
Ethylene terephthalate cyclic trimer is a chemical compound formed from the trimerization of ethylene terephthalate, a key intermediate in polyester production. This cyclic trimer is significant in the polymer industry, particularly in the recycling of polyethylene terephthalate (PET) plastics. It serves as an indicator of thermal degradation and is a byproduct during PET processing. Understanding and managing its formation is crucial for optimizing polymer properties and enhancing the quality of recycled PET materials.
CAS Number | 7441-32-9 |
Synonyms | 3,6,13,16,23,26-Hexaoxatetracyclo[26.2.2.28,11.218,21]hexatriaconta-8,10,18,20,28,30,31,33,35-nonaene-2,7,12,17,22,27-hexone; ?Terephthalic acid, trimol. cyclic ethylene ester; Ethylene glycol, trimol. cyclic terephthalate; 1,4,11,14,21,24-Hexaoxatri |
Molecular Formula | C30H24O12 |
Purity | ≥95% |
Storage | -20°C |
InChI | InChI=1S/C30H24O12/c31-25-19-1-2-20(4-3-19)26(32)38-15-16-40-28(34)22-9-11-24(12-10-22)30(36)42-18-17-41-29(35)23-7-5-21(6-8-23)27(33)39-14-13-37-25/h1-12H,13-18H2 |
InChIKey | IICRGUKQYYOPIG-UHFFFAOYSA-N |
SMILES | C1COC(=O)C2=CC=C(C=C2)C(=O)OCCOC(=O)C3=CC=C(C=C3)C(=O)OCCOC(=O)C4=CC=C(C=C4)C(=O)O1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |