Home
>
Chemical Reagents>Heterocyclic Building Blocks> Ethyl (Z)-2-(2-amino-4-thiazolyl)-2-methoxyiminoacetate
For research use only. Not for therapeutic Use.
Ethyl (Z)-2-(2-amino-4-thiazolyl)-2-methoxyiminoacetate(Cat No.:L006796). It features a thiazole ring substituted with an amino group at the 2-position and a methoxyiminoacetate group at the 4-position. This compound is important in medicinal chemistry and drug development, often used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for diverse chemical transformations, making it valuable in the creation of complex molecules.
CAS Number | 60846-15-3 |
Molecular Formula | C8H11N3O3S |
Purity | ≥95% |
IUPAC Name | ethyl (2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetate |
InChI | InChI=1S/C8H11N3O3S/c1-3-14-7(12)6(11-13-2)5-4-15-8(9)10-5/h4H,3H2,1-2H3,(H2,9,10)/b11-6+ |
InChIKey | POBMBNPEUPDXRS-IZZDOVSWSA-N |
SMILES | CCOC(=O)C(=NOC)C1=CSC(=N1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |