For research use only. Not for therapeutic Use.
| CAS Number | 16982-21-1 |
| Synonyms | Ethyl Aminothioxoacetate; 2-Amino-2-thioxo-acetic Acid Ethyl Ester; Aminothioxo-acetic Acid Ethyl Ester; (Amino)(thioxo)acetic Acid Ethyl Ester; 2-Thiooxamic Acid Ethyl Ester; Ethyl 2-Amino-2-thioxoacetate; NSC 174676; |
| Molecular Formula | C4H7NO2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-amino-2-sulfanylideneacetate |
| InChI | InChI=1S/C4H7NO2S/c1-2-7-4(6)3(5)8/h2H2,1H3,(H2,5,8) |
| InChIKey | YMBMCMOZIGSBOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=S)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |