For research use only. Not for therapeutic Use.
Ethyl methyl carbonate（Cat No.:L012634）is an organic ester with the chemical formula C4H8O3, featuring an ethyl group and a methyl group attached to a carbonate functional group. It is a colorless, volatile liquid with a mild, pleasant odor and is used as a solvent in various industrial applications, including coatings, paints, and adhesives. Additionally, it serves as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Ethyl methyl carbonate is also employed as a component in electrolytes for lithium-ion batteries due to its good solubility and low viscosity, enhancing battery performance.
| CAS Number | 623-53-0 |
| Molecular Formula | C4H8O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl methyl carbonate |
| InChI | InChI=1S/C4H8O3/c1-3-7-4(5)6-2/h3H2,1-2H3 |
| InChIKey | JBTWLSYIZRCDFO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
