For research use only. Not for therapeutic Use.
Ethyl Isoquinoline-3-carboxylate(Cat No.:L044613)is a key intermediate in the synthesis of various heterocyclic compounds, particularly in pharmaceutical research. This compound features an ethyl ester group attached to the 3-position of the isoquinoline ring, offering versatility for chemical modifications. It is widely used in the development of bioactive molecules, including potential anticancer, antiviral, and anti-inflammatory agents. Its structure allows for easy incorporation into more complex molecules, making it a valuable building block in medicinal chemistry and drug discovery processes, contributing to the creation of new therapeutic agents.
CAS Number | 50458-79-2 |
Molecular Formula | C12H11NO2 |
Purity | ≥95% |
IUPAC Name | ethyl isoquinoline-3-carboxylate |
InChI | InChI=1S/C12H11NO2/c1-2-15-12(14)11-7-9-5-3-4-6-10(9)8-13-11/h3-8H,2H2,1H3 |
InChIKey | IFSCYCNNAIADLI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=CC=CC=C2C=N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |