For research use only. Not for therapeutic Use.
Ethyl acetylglycinate(Cat No.:R015030)is an ester of glycine, featuring an acetyl group attached to the amino acid structure, with an ethyl ester group at the carboxyl end. It is often used in organic synthesis and pharmaceutical research due to its potential bioactivity. This compound can act as a chelating agent, interacting with metal ions, and may have applications in the formulation of therapeutic agents targeting specific metabolic pathways. Ethyl acetylglycinate is studied for its possible anti-inflammatory, antioxidant, or neuroprotective properties, and is also explored in drug design for various medical conditions.
| CAS Number | 1906-82-7 |
| Synonyms | ethyl 2-acetamidoacetate |
| Molecular Formula | C6H11NO3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-acetamidoacetate |
| InChI | InChI=1S/C6H11NO3/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8) |
| InChIKey | AMBDTBHJFINMSE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |