For research use only. Not for therapeutic Use.
Ethyl Acetate (Cat.No:R017901) is a common organic compound widely used as a solvent in various industries, including coatings, paints, adhesives, and pharmaceuticals. Its pleasant fruity odor also makes it a component in flavorings and fragrances. Ethyl Acetate’s low toxicity and good solvency make it a versatile and valuable chemical.
| CAS Number | 141-78-6 |
| Synonyms | Acetic-2,2,2 Acid Ethyl Ester; Acetic Acid Ethyl Ester; |
| Molecular Formula | C4H8O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl acetate |
| InChI | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| InChIKey | XEKOWRVHYACXOJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |