For research use only. Not for therapeutic Use.
Ethyl 5-chloro-4-formylthiophene-2-carboxylate(Cat No.:L036602)is a heterocyclic compound used in organic synthesis and pharmaceutical research. The molecule features a thiophene ring with a chlorine atom at the 5-position, a formyl group at the 4-position, and an ethyl ester at the 2-position, providing unique reactivity. This compound is valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Its functional groups allow for diverse chemical modifications, making it essential for researchers focused on creating novel therapeutic agents and advanced materials.
CAS Number | 74598-06-4 |
Molecular Formula | C8H7ClO3S |
Purity | ≥95% |
IUPAC Name | ethyl 5-chloro-4-formylthiophene-2-carboxylate |
InChI | InChI=1S/C8H7ClO3S/c1-2-12-8(11)6-3-5(4-10)7(9)13-6/h3-4H,2H2,1H3 |
InChIKey | GJTHZLGIEUAJIM-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC(=C(S1)Cl)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |