Ethyl 5-bromothiophene-3-carboxylate - CAS 170355-38-1

Ethyl 5-bromothiophene-3-carboxylate (Cat No.:M132061) is a chemical compound belonging to the thiophene derivative class. Also known as ethyl 5-bromo-1,3-thiophene-2-carboxylate, it finds applications in organic synthesis and medicinal chemistry. It serves as a valuable building block for the synthesis of various compounds, including pharmaceutical intermediates and agrochemicals. Ethyl 5-bromothiophene-3-carboxylate can undergo diverse chemical reactions, allowing the creation of complex molecules with modified properties.

Catalog Number: M132061

CAS Number: 170355-38-1

PubChem Substance ID:355166971

Molecular Formula: C7H7BrO2S

Molecular Weight:235.10

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C7H7BrO2S
Molecular Weight235.10
Purity≥95%
Storageunder inert gas (nitrogen or Argon) at 2–8 °C

Computed Descriptor

IUPAC Nameethyl 5-bromothiophene-3-carboxylate
InChIInChI=1S/C7H7BrO2S/c1-2-10-7(9)5-3-6(8)11-4-5/h3-4H,2H2,1H3
InChIKeyLUYMKCLOYODOEI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=C1)Br