Ethyl 5-bromothiophene-3-carboxylate - CAS 170355-38-1
Ethyl 5-bromothiophene-3-carboxylate (Cat No.:M132061) is a chemical compound belonging to the thiophene derivative class. Also known as ethyl 5-bromo-1,3-thiophene-2-carboxylate, it finds applications in organic synthesis and medicinal chemistry. It serves as a valuable building block for the synthesis of various compounds, including pharmaceutical intermediates and agrochemicals. Ethyl 5-bromothiophene-3-carboxylate can undergo diverse chemical reactions, allowing the creation of complex molecules with modified properties.
Catalog Number: M132061
CAS Number: 170355-38-1
PubChem Substance ID:355166971
Molecular Formula: C7H7BrO2S
Molecular Weight:235.10
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C7H7BrO2S |
---|---|
Molecular Weight | 235.10 |
Purity | ≥95% |
Storage | under inert gas (nitrogen or Argon) at 2–8 °C |
Computed Descriptor
IUPAC Name | ethyl 5-bromothiophene-3-carboxylate |
---|---|
InChI | InChI=1S/C7H7BrO2S/c1-2-10-7(9)5-3-6(8)11-4-5/h3-4H,2H2,1H3 |
InChIKey | LUYMKCLOYODOEI-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CSC(=C1)Br |