For research use only. Not for therapeutic Use.
Ethyl 4-methyl-5-nitropicolinate is an aromatic compound featuring a nitro group at the 5-position and a methyl group at the 4-position of a picolinate structure, with an ethyl ester functionality. This compound is significant in organic synthesis and medicinal chemistry, where it may exhibit potential biological activities, including antimicrobial and anti-inflammatory properties. The combination of the nitro and methyl substituents enhances its reactivity, making it a valuable intermediate for developing novel therapeutic agents and exploring new applications in drug discovery.
CAS Number | 868551-26-2 |
Molecular Formula | C9H10N2O4 |
Purity | ≥95% |
IUPAC Name | ethyl 4-methyl-5-nitropyridine-2-carboxylate |
InChI | InChI=1S/C9H10N2O4/c1-3-15-9(12)7-4-6(2)8(5-10-7)11(13)14/h4-5H,3H2,1-2H3 |
InChIKey | SZHWIVMKQWHMBS-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=NC=C(C(=C1)C)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |