For research use only. Not for therapeutic Use.
| CAS Number | 17138-28-2 |
| Synonyms | 4-Hydroxyphenylacetic Acid Ethyl Ester; 4-Hydroxybenzeneacetic Acid Ethyl Ester; (p-Hydroxyphenyl)acetic Acid Ethyl Ester; 2-(4-Hydroxyphenyl)acetic Acid Ethyl Ester; Ethyl (p-Hydroxyphenyl)acetate; Ethyl 2-(4-Hydroxyphenyl)acetate; Ethyl 2-(p-Hydrox |
| Molecular Formula | C10H12O3 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | ethyl 2-(4-hydroxyphenyl)acetate |
| InChI | InChI=1S/C10H12O3/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
| InChIKey | HYUPPKVFCGIMDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |