For research use only. Not for therapeutic Use.
Ethyl 4-(cyclopropylamino)-2-(methylthio)pyrimidine-5-carboxylate(CAT: L019224) is a functionalized pyrimidine derivative with applications in pharmaceutical research and development. The structure features a cyclopropylamino group at the 4-position and a methylthio group at the 2-position on the pyrimidine ring, alongside an ethyl ester at the 5-position. This combination enhances its reactivity and provides opportunities for additional modifications, making it suitable for synthesizing bioactive molecules. Its structural characteristics are often leveraged in designing compounds that target specific enzymes or receptors, such as kinase inhibitors or antimicrobial agents, due to the pyrimidine core’s known biological relevance. This compound is also valued in medicinal chemistry for developing molecules with improved potency, selectivity, and pharmacokinetic profiles.
CAS Number | 651734-65-5 |
Molecular Formula | C11H15N3O2S |
Purity | ≥95% |
IUPAC Name | ethyl 4-(cyclopropylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
InChI | InChI=1S/C11H15N3O2S/c1-3-16-10(15)8-6-12-11(17-2)14-9(8)13-7-4-5-7/h6-7H,3-5H2,1-2H3,(H,12,13,14) |
InChIKey | VOLYYVCUCYOUDG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |