For research use only. Not for therapeutic Use.
Ethyl 4-Bromobutanoate（Cat No.:R022802）is a versatile organic intermediate featuring both ester and alkyl bromide functional groups, making it ideal for diverse transformations in organic synthesis. Commonly used in the preparation of pharmaceuticals, agrochemicals, and fine chemicals, it participates readily in nucleophilic substitution, ester hydrolysis, and coupling reactions. Its bifunctional nature allows for selective modifications, enabling the construction of complex molecular scaffolds. Ethyl 4-Bromobutanoate is particularly useful in carbon–carbon bond formation and synthesis of heterocycles, making it a valuable reagent in medicinal chemistry and research laboratories.
| CAS Number | 2969-81-5 |
| Synonyms | 1-Bromo-3-(carboethoxy)propane; 3-(Ethoxycarbonyl)propyl Bromide; 4-Bromobutanoic Acid Ethyl Ester; 4-Bromobutyric Acid Ethyl Ester; Ethyl 4-Bromobutyrate; Ethyl γ-Bromobutyrate; NSC 133462; γ-Bromobutyric Acid Ethyl Ester |
| Molecular Formula | C6H11BrO2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | ethyl 4-bromobutanoate |
| InChI | InChI=1S/C6H11BrO2/c1-2-9-6(8)4-3-5-7/h2-5H2,1H3 |
| InChIKey | XBPOBCXHALHJFP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
