For research use only. Not for therapeutic Use.
Ethyl 4-amino-3-bromo-5-nitrobenzoate is an aromatic compound featuring an ethyl ester, an amino group at the 4-position, a bromo group at the 3-position, and a nitro group at the 5-position of a benzoate structure. This compound is significant in medicinal chemistry due to its potential biological activities, including antibacterial and anticancer properties. The combination of functional groups enhances its reactivity, making it a valuable intermediate for the synthesis of more complex pharmaceuticals and compounds in organic synthesis.
| CAS Number | 82760-42-7 |
| Molecular Formula | C9H9BrN2O4 |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-amino-3-bromo-5-nitrobenzoate |
| InChI | InChI=1S/C9H9BrN2O4/c1-2-16-9(13)5-3-6(10)8(11)7(4-5)12(14)15/h3-4H,2,11H2,1H3 |
| InChIKey | QANVLXVFIRTXFG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)Br)N)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |