For research use only. Not for therapeutic Use.
Ethyl 3-(4-fluorophenyl)propanoate(CAT: L039106) is an ester compound featuring a 4-fluorophenyl group attached to a propanoate backbone. This versatile molecule is widely used in pharmaceutical and chemical research as an intermediate in the synthesis of bioactive compounds, including potential therapeutic agents and agrochemicals. Its structure provides opportunities for diverse chemical modifications, making it valuable for medicinal chemistry applications. With high purity and excellent stability, Ethyl 3-(4-fluorophenyl)propanoate is an essential building block for researchers developing innovative solutions in organic synthesis and drug discovery.
CAS Number | 7116-38-3 |
Molecular Formula | C11H13FO2 |
Purity | ≥95% |
IUPAC Name | ethyl 3-(4-fluorophenyl)propanoate |
InChI | InChI=1S/C11H13FO2/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-4,6-7H,2,5,8H2,1H3 |
InChIKey | RFDMUTQYDLCBFL-UHFFFAOYSA-N |
SMILES | CCOC(=O)CCC1=CC=C(C=C1)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |