Ethyl 3-(3-aminobenzamido)benzoate - CAS 1307391-08-7

Ethyl 3-(3-aminobenzamido)benzoate(Cat No.:L007993), is a chemical compound used in medicinal chemistry and drug research. It features a benzoate backbone with an ethyl ester group and a 3-aminobenzamido group attached at specific positions. This compound serves as a valuable building block in the synthesis of bioactive molecules, including potential drug candidates. Researchers study its interactions with biological targets to explore its pharmacological properties, making it significant in drug discovery efforts.

Catalog Number: L007993

CAS Number: 1307391-08-7

Molecular Formula: C16H16N2O3

Molecular Weight:284.31

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C16H16N2O3
Molecular Weight284.31
Purity≥95%
StorageRoom Temperature

Computed Descriptor

IUPAC Nameethyl 3-[(3-aminobenzoyl)amino]benzoate
InChIInChI=1S/C16H16N2O3/c1-2-21-16(20)12-6-4-8-14(10-12)18-15(19)11-5-3-7-13(17)9-11/h3-10H,2,17H2,1H3,(H,18,19)
InChIKeyFXFOPEYZMWRLAD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=CC=C1)NC(=O)C2=CC(=CC=C2)N