For research use only. Not for therapeutic Use.
Ethyl 2,4,6-triisopropylbenzoate(Cat No.:L007036), is an organic compound used primarily as a fragrance ingredient and flavoring agent. Its chemical structure includes a benzoate moiety substituted with three isopropyl groups. This compound imparts a sweet, floral, and slightly fruity aroma. It is commonly employed in perfumes, colognes, and cosmetic products due to its pleasant scent. Additionally, it is used in the flavor industry to enhance the taste of various food and beverage products. Ethyl 2,4,6-triisopropylbenzoate’s unique odor profile makes it valuable in creating distinctive fragrances and flavors, contributing to the sensory appeal of consumer goods.
| CAS Number | 63846-76-4 |
| Molecular Formula | C18H28O2 |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | ethyl 2,4,6-tri(propan-2-yl)benzoate |
| InChI | InChI=1S/C18H28O2/c1-8-20-18(19)17-15(12(4)5)9-14(11(2)3)10-16(17)13(6)7/h9-13H,8H2,1-7H3 |
| InChIKey | SNMLXTDVQDHSKS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |