For research use only. Not for therapeutic Use.
Ethyl 2-Methylacetoacetate(CAT: R046830) is an important intermediate in organic synthesis, especially valued in the production of pharmaceuticals, agrochemicals, and fragrances. As a β-keto ester, it is highly versatile, allowing for various transformations such as alkylation, acylation, and condensation reactions. Its reactive methylene group facilitates enolate formation, making it suitable for constructing complex molecular frameworks through C-C bond formation. This compound is often employed in the synthesis of heterocycles, amino acids, and other biologically active compounds. Its stability and ease of handling make Ethyl 2-Methylacetoacetate a widely used building block in advanced organic and medicinal chemistry research.
| CAS Number | 609-14-3 |
| Synonyms | 2-Methyl-3-oxo-butanoic Acid Ethyl Ester; α-Methyl-acetoacetic Acid Ethyl Ester; 2-Methyl-3-oxobutanoic Acid Ethyl Ester; Ethyl (+/-)-2-Methylacetoacetate; Ethyl 2-Acetylpropanoate; NSC 1102; |
| Molecular Formula | C7H12O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-methyl-3-oxobutanoate |
| InChI | InChI=1S/C7H12O3/c1-4-10-7(9)5(2)6(3)8/h5H,4H2,1-3H3 |
| InChIKey | FNENWZWNOPCZGK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |