For research use only. Not for therapeutic Use.
Ethyl 2-ethylhexanoate(Cat No.:R064181)is an ester formed from 2-ethylhexanoic acid and ethanol, featuring a branched alkyl chain that imparts hydrophobic character and a fruity, slightly floral odor. It is commonly used as a flavoring agent, fragrance component, and solvent in coatings, plasticizers, and lubricants. Its branched structure enhances volatility and spreadability, making it valuable in cosmetics and personal care formulations. Additionally, it serves as an intermediate in organic synthesis and in the preparation of metal salts for industrial catalysts. The ester functional group enables further reactivity in transesterification and hydrolysis reactions.
| CAS Number | 2983-37-1 |
| Synonyms | Ethyl α-Ethylcaproate; Irotyl |
| Molecular Formula | C10H20O2 |
| Purity | ≥95% |
| Storage | Store at +4°C |
| IUPAC Name | ethyl 2-ethylhexanoate |
| InChI | InChI=1S/C10H20O2/c1-4-7-8-9(5-2)10(11)12-6-3/h9H,4-8H2,1-3H3 |
| InChIKey | YXAGIRHBJJLWHW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |