For research use only. Not for therapeutic Use.
Ethyl 2-cyanoacrylate(CAT: R009840) is a chemical compound known for its adhesive properties. It is commonly used in the manufacturing of instant or “super” glues. Ethyl 2-cyanoacrylate polymerizes rapidly upon contact with moisture, forming strong bonds between various surfaces, including metals, plastics, and rubber. Its fast-curing and high-strength characteristics make it a popular choice for a wide range of bonding applications in industries such as construction, automotive, and manufacturing.
| CAS Number | 7085-85-0 |
| Synonyms | 2-Cyano-2-propenoic Acid Ethyl Ester; 2-Cyanoacrylic Acid Ethyl Ester; 910EM; ACE-E 50; ACE-EE; Adhesive 502; Anacure 3020; Loctite E 406; Sicomet 5195; Sicomet 8400; TB 1743; TK 200; |
| Molecular Formula | C6H7NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-cyanoprop-2-enoate |
| InChI | InChI=1S/C6H7NO2/c1-3-9-6(8)5(2)4-7/h2-3H2,1H3 |
| InChIKey | FGBJXOREULPLGL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)C#N |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |