For research use only. Not for therapeutic Use.
Ethyl 2-bromoimidazo[5,1-b]thiazole-7-carboxylate is a heterocyclic compound characterized by an imidazo-thiazole ring with a bromine atom at the 2-position and an ethyl ester at the 7-position. This unique structure imparts interesting electronic and chemical properties, making it valuable in organic synthesis and medicinal chemistry. The bromine substituent enhances reactivity, allowing for various chemical transformations. This compound may serve as an important intermediate for developing pharmaceuticals and agrochemicals, facilitating research into structure-activity relationships and novel applications.
| CAS Number | 901122-44-9 |
| Molecular Formula | C8H7BrN2O2S |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-bromoimidazo[5,1-b][1,3]thiazole-7-carboxylate |
| InChI | InChI=1S/C8H7BrN2O2S/c1-2-13-8(12)6-7-11(4-10-6)3-5(9)14-7/h3-4H,2H2,1H3 |
| InChIKey | DMUMAAIQJXASCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2N(C=C(S2)Br)C=N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |