1. Home
  2. Product
  3. Chemical Reagents
  4. Heterocyclic Building Blocks
  5. Ethyl 2-(Boc-amino)oxazole-4-carboxylate

Ethyl 2-(Boc-amino)oxazole-4-carboxylate - CAS 244236-51-9

Ethyl 2-(Boc-amino)oxazole-4-carboxylate (Cat.No:L004812) is a key compound in organic synthesis. Featuring an oxazole ring with a Boc-protected amino group, it serves as a valuable intermediate in the construction of complex molecules. This compound is widely utilized in the pharmaceutical industry for the synthesis of diverse bioactive compounds. Its versatile reactivity and specific attributes make it an essential building block in the development of pharmaceutical agents, underscoring its significance in contemporary chemical research and drug discovery.

Catalog Number: L004812

CAS Number: 244236-51-9

Molecular Formula: C11H16N2O5

Molecular Weight:256.25

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C11H16N2O5
Molecular Weight256.25
Purity≥95%

Computed Descriptor

IUPAC Nameethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-oxazole-4-carboxylate
InChIInChI=1S/C11H16N2O5/c1-5-16-8(14)7-6-17-9(12-7)13-10(15)18-11(2,3)4/h6H,5H2,1-4H3,(H,12,13,15)
InChIKeySRIWWYRMCONFAS-UHFFFAOYSA-N
SMILESCCOC(=O)C1=COC(=N1)NC(=O)OC(C)(C)C