For research use only. Not for therapeutic Use.
Ethyl 2-(4-fluorophenyl)acetate(Cat No.:L044324)is an aromatic ester featuring a 4-fluorophenyl group attached to the α-position of an ethyl acetate moiety. This compound is widely used as a building block in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. The fluorine atom enhances metabolic stability and modulates biological activity, making it useful in drug design. Its ester functionality allows for versatile chemical transformations, such as hydrolysis, reduction, or condensation reactions. Ethyl 2-(4-fluorophenyl)acetate is especially valuable in preparing non-steroidal anti-inflammatory drugs and other bioactive phenylacetic acid derivatives.
| CAS Number | 587-88-2 |
| Molecular Formula | C10H11FO2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-(4-fluorophenyl)acetate |
| InChI | InChI=1S/C10H11FO2/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6H,2,7H2,1H3 |
| InChIKey | VMWJHHAOVXQCLE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |