For research use only. Not for therapeutic Use.
Ethyl 2-(4-bromophenyl)-2-methylpropanoate is an ester compound featuring a 4-bromophenyl group and a branched methylpropanoate core, widely used in pharmaceutical and organic synthesis. Its bromine atom enables further functionalization through cross-coupling reactions, making it a versatile intermediate for constructing complex molecules. This compound is particularly valuable in developing bioactive molecules and studying structure-activity relationships. Its stability and reactivity make it ideal for medicinal chemistry applications, supporting the synthesis of compounds for drug discovery and materials research.
CAS Number | 32454-36-7 |
Molecular Formula | C12H15BrO2 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(4-bromophenyl)-2-methylpropanoate |
InChI | InChI=1S/C12H15BrO2/c1-4-15-11(14)12(2,3)9-5-7-10(13)8-6-9/h5-8H,4H2,1-3H3 |
InChIKey | XTSCLIBGCPXCLH-UHFFFAOYSA-N |
SMILES | CCOC(=O)C(C)(C)C1=CC=C(C=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |