For research use only. Not for therapeutic Use.
Ethyl 2-((3-fluoro-4-(methylcarbamoyl)phenyl)amino)-2-methylpropanoate(Cat No.:M032230)is a synthetic organic compound with potential pharmaceutical applications. It consists of an ethyl ester group linked to a 2-methylpropanoate backbone, with a phenyl group substituted by a fluorine atom and a methylcarbamoyl group. This structure suggests the compound may have bioactive properties, such as modulating enzyme activity or interacting with specific biological receptors. It is studied for its potential use in drug development, particularly in fields like cancer, inflammation, or metabolic diseases.
| CAS Number | 1258638-92-4 |
| Synonyms | ethyl 2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methylpropanoate |
| Molecular Formula | C14H19FN2O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[3-fluoro-4-(methylcarbamoyl)anilino]-2-methylpropanoate |
| InChI | InChI=1S/C14H19FN2O3/c1-5-20-13(19)14(2,3)17-9-6-7-10(11(15)8-9)12(18)16-4/h6-8,17H,5H2,1-4H3,(H,16,18) |
| InChIKey | GBQUYIPPBGFGPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)NC1=CC(=C(C=C1)C(=O)NC)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |