For research use only. Not for therapeutic Use.
Ethyl 2-(2-iodoethoxy)acetate (Cat.No:L003727) is a significant chemical compound used in various organic synthesis processes. Its structure incorporates an iodine-substituted ethoxy group, conferring unique reactivity and versatility. This compound serves as a valuable intermediate in the preparation of specialized organic molecules with applications in pharmaceuticals and materials science.
CAS Number | 56703-25-4 |
Molecular Formula | C6H11IO3 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(2-iodoethoxy)acetate |
InChI | InChI=1S/C6H11IO3/c1-2-10-6(8)5-9-4-3-7/h2-5H2,1H3 |
InChIKey | MVCSLDOOVLPFQU-UHFFFAOYSA-N |
SMILES | CCOC(=O)COCCI |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |