Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> Ethyl 2-(1-carbamoylpiperidin-4-yl)acetate
For research use only. Not for therapeutic Use.
Ethyl 2-(1-carbamoylpiperidin-4-yl)acetate(CAT: L002424), an ethyl ester derivative with a piperidinyl carbamide substituent, holds significance in pharmaceutical and organic chemistry. The piperidinyl carbamide suggests potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on enzymatic pathways or receptors, potentially influencing therapeutic pathways. Its ethyl ester group offers opportunities for chemical modifications, crucial for fine-tuning properties or creating derivatives.
CAS Number | 279236-51-0 |
Molecular Formula | C10H18N2O3 |
Purity | ≥95% |
IUPAC Name | ethyl 2-(1-carbamoylpiperidin-4-yl)acetate |
InChI | InChI=1S/C10H18N2O3/c1-2-15-9(13)7-8-3-5-12(6-4-8)10(11)14/h8H,2-7H2,1H3,(H2,11,14) |
InChIKey | XCWCWYPDHUQBMP-UHFFFAOYSA-N |