For research use only. Not for therapeutic Use.
Ethyl 1-methylpiperidine-4-carboxylate is an organic compound with the molecular formula C₉H₁₅N₁O₂. It features a piperidine ring with a methyl group at the 1-position and an ethyl ester at the 4-position. This compound typically appears as a liquid and is of interest in organic synthesis and medicinal chemistry. Its unique structure makes it a valuable intermediate for developing various pharmaceuticals and bioactive molecules. Additionally, it may exhibit interesting biological activities, making it a candidate for further research in therapeutic applications.
CAS Number | 24252-37-7 |
Molecular Formula | C9H17NO2 |
Purity | ≥95% |
IUPAC Name | ethyl 1-methylpiperidine-4-carboxylate |
InChI | InChI=1S/C9H17NO2/c1-3-12-9(11)8-4-6-10(2)7-5-8/h8H,3-7H2,1-2H3 |
InChIKey | JWXOOQCMGJBSML-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CCN(CC1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |