Home
>
Chemical Reagents>Heterocyclic Building Blocks> ethyl 1-methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylate
For research use only. Not for therapeutic Use.
Ethyl 1-methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylate(Cat No.:L010365)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a fused pyrrole-pyridine ring system with a methyl group at the nitrogen atom and an ethyl ester group at the 6-position. This structure offers unique reactivity, making it a valuable intermediate in the synthesis of biologically active molecules, including potential drug candidates. The ethyl ester functionality allows for versatile chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced therapeutic agents.
CAS Number | 2114651-27-1 |
Molecular Formula | C11H12N2O2 |
Purity | ≥95% |
IUPAC Name | ethyl 1-methylpyrrolo[3,2-b]pyridine-6-carboxylate |
InChI | InChI=1S/C11H12N2O2/c1-3-15-11(14)8-6-10-9(12-7-8)4-5-13(10)2/h4-7H,3H2,1-2H3 |
InChIKey | LEIJRKJDDNAJHV-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1=CC2=C(C=CN2C)N=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |