For research use only. Not for therapeutic Use.
Ethyl 1-Boc-piperidine-2-carboxylate(CAT: L041404) is a high-purity compound widely used in pharmaceutical and chemical research. Featuring a piperidine ring protected with a Boc (tert-butoxycarbonyl) group and an ethyl ester functional group, it serves as a versatile intermediate in the synthesis of complex organic molecules, including pharmaceuticals and biologically active compounds. Its protected structure ensures stability during multi-step reactions, while its reactive ester group facilitates diverse chemical transformations. With reliable performance and adaptability, Ethyl 1-Boc-piperidine-2-carboxylate is a valuable building block for advancing medicinal chemistry and innovative synthetic applications.
CAS Number | 362703-48-8 |
Molecular Formula | C13H23NO4 |
Purity | ≥95% |
IUPAC Name | 1-O-tert-butyl 2-O-ethyl piperidine-1,2-dicarboxylate |
InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)10-8-6-7-9-14(10)12(16)18-13(2,3)4/h10H,5-9H2,1-4H3 |
InChIKey | KBDNAOCLKIBYPH-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1CCCCN1C(=O)OC(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |