Home
>
Chemical Reagents>Organic Building Blocks> Ethyl 1-aminocyclopropanecarboxylate hydrochloride
For research use only. Not for therapeutic Use.
Ethyl 1-aminocyclopropanecarboxylate hydrochloride(Cat No.:L024464)is a cyclic amino acid derivative used in organic synthesis, particularly in the development of pharmaceuticals. The compound features a cyclopropane ring with an amino group and an ester functional group, making it a versatile intermediate for creating complex molecules. As a hydrochloride salt, it is more stable and soluble, facilitating its use in various reactions. This compound is often employed in the synthesis of bioactive molecules, including enzyme inhibitors and drug candidates, playing a crucial role in medicinal chemistry.
| CAS Number | 42303-42-4 |
| Molecular Formula | C6H12ClNO2 |
| Purity | ≥95% |
| IUPAC Name | ethyl 1-aminocyclopropane-1-carboxylate;hydrochloride |
| InChI | InChI=1S/C6H11NO2.ClH/c1-2-9-5(8)6(7)3-4-6;/h2-4,7H2,1H3;1H |
| InChIKey | XFNUTZWASODOQK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CC1)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |