For research use only. Not for therapeutic Use.
Ethofumesate（Cat No.:R069429）is a selective herbicide primarily used for pre- and early post-emergence control of annual grasses and broadleaf weeds in crops such as sugar beets, onions, and turfgrass. It acts by inhibiting cell division and growth in susceptible weed species, disrupting lipid and protein biosynthesis. Ethofumesate is absorbed through both roots and shoots, offering systemic activity and long-lasting residual control. Its effectiveness and compatibility with other herbicides make it a valuable component of integrated weed management strategies. It is known for its crop safety and minimal environmental persistence under recommended use conditions.
| CAS Number | 26225-79-6 |
| Synonyms | (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methanesulfonate |
| Molecular Formula | C13H18O5S |
| Purity | ≥95% |
| IUPAC Name | (2-ethoxy-3,3-dimethyl-2H-1-benzofuran-5-yl) methanesulfonate |
| InChI | InChI=1S/C13H18O5S/c1-5-16-12-13(2,3)10-8-9(18-19(4,14)15)6-7-11(10)17-12/h6-8,12H,5H2,1-4H3 |
| InChIKey | IRCMYGHHKLLGHV-UHFFFAOYSA-N |
| SMILES | CCOC1C(C2=C(O1)C=CC(=C2)OS(=O)(=O)C)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
