Ethanol-d5（Cat No.:R053930） is a high-purity deuterated compound featuring five deuterium atoms, essential for advanced research in chemistry, biochemistry, and environmental science. This isotopically labeled version of ethanol is crucial for studies involving metabolic pathways, reaction mechanisms, and analytical method development. Its stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for use in NMR spectroscopy, mass spectrometry, and tracer studies, Ethanol-d5 integrates seamlessly into existing protocols, offering a dependable and cost-effective solution for high-precision scientific investigations across various research fields.
| Catalog Number | R053930 |
| CAS Number | 1859-08-1 |
| Synonyms | Ethyl Alcohol-d5; Alcohol-d5; Alcohol-d5 Anhydrous; Algrain-d5; Anhydrol-d5; Bioethanol-d5; Black Warrant-d5; CDA 19-d5; Denatured Alcohol-d5; Denatured Ethanol-d5; Desinfektol EL-d5; Esumiru WK 88-d5; Ethicap-d5; Ethyl Hydrate-d5; Ethyl Hydroxide-d5 |
| Molecular Formula | C2H6O |
| Purity | 95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 1,1,2,2,2-pentadeuterioethanol |
| InChI | InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3/i1D3,2D2 |
| InChIKey | LFQSCWFLJHTTHZ-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])O |
