For research use only. Not for therapeutic Use.
Erythro-5-hydroxy-L-lysine(Cat No.:M020686) is a modified amino acid derived from L-lysine, one of the essential amino acids important in protein synthesis. The “erythro” designation refers to a specific stereochemistry at the molecule’s chiral centers, giving it unique structural properties. This hydroxylated form of lysine plays a role in biological processes by influencing collagen stability and maturation, which are crucial for maintaining the structure and integrity of connective tissue. Its presence and modifications in proteins can affect various physiological functions, making it a focus in studies related to metabolism and disease mechanisms.
| CAS Number | 1190-94-9 |
| Synonyms | erythro-5-hydroxy-L-lysine;(2S,5R)-2,6-diamino-5-hydroxy-hexanoic acid;5-Hydroxylysine;(5R)-5-Hydroxy-L-lysine;L-erythro-Hydroxylysine |
| Molecular Formula | C6H14N2O3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (2S,5R)-2,6-diamino-5-hydroxyhexanoic acid |
| InChI | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5+/m1/s1 |
| InChIKey | YSMODUONRAFBET-UHNVWZDZSA-N |
| SMILES | C(CC(C(=O)O)N)C(CN)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |