Ergosterol glucoside(CAT: R066437) is a naturally occurring sterol glucoside and is commonly found in fungi such as yeast and mushrooms. In addition to its use as a biomarker, ergosterol glucoside has also been investigated for its potential health benefits. It has been found to exhibit antioxidant and anti-inflammatory properties and may have the potential as a therapeutic agent in the treatment of various diseases such as cancer, diabetes, and Alzheimer’s disease.
Catalog Number | R066437 |
CAS Number | 130155-33-8 |
Molecular Formula | C34H54O6 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C34H54O6/c1-19(2)20(3)7-8-21(4)25-11-12-26-24-10-9-22-17-23(13-15-33(22,5)27(24)14-16-34(25,26)6)39-32-31(38)30(37)29(36)28(18-35)40-32/h7-10,19-21,23,25-32,35-38H,11-18H2,1-6H3/b8-7+/t20-,21+,23-,25+,26-,27-,28+,29+,30-,31+,32+,33-,34+/m0/s1 |
InChIKey | MKZPNGBJJJZJMI-GBLVNJONSA-N |
SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)OC5C(C(C(C(O5)CO)O)O)O)C)C |