For research use only. Not for therapeutic Use.
Erdosteine is a mucolytic which is used in treatment of excessive viscous mucus.
| CAS Number | 84611-23-4 |
| Synonyms | KW-9144 |
| Molecular Formula | C8H11NO4S2 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | 3 years -20C powder |
| IUPAC Name | 2-[2-oxo-2-[(2-oxothiolan-3-yl)amino]ethyl]sulfanylacetic acid |
| InChI | InChI=1S/C8H11NO4S2/c10-6(3-14-4-7(11)12)9-5-1-2-15-8(5)13/h5H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | QGFORSXNKQLDNO-UHFFFAOYSA-N |
| SMILES | C1CSC(=O)C1NC(=O)CSCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |