Erdafitinib,(CAT: I001324) is a potent and selective inhibitor of fibroblast growth factor receptor (FGFR) tyrosine kinases. By targeting FGFRs, erdafitinib interferes with aberrant signaling pathways involved in cell growth, survival, and angiogenesis. This pharmacologic action makes erdafitinib particularly effective against cancers harboring specific FGFR genetic alterations, such as FGFR2 fusions or mutations. Erdafitinib has demonstrated clinical efficacy in the treatment of metastatic urothelial carcinoma, providing a targeted therapeutic option for patients with these genetic alterations.
| Catalog Number | I001324 |
| CAS Number | 1346242-81-6 |
| Synonyms | Erdafitinib |
| Molecular Formula | C25H30N6O2 |
| Purity | 95% |
| Target | FGFR |
| Solubility | DMSO: ≥ 33 mg/mL |
| Storage | -20°C |
| IC50 | 9/8.5/8.5/8.25 (pIC50, for FGFR1/2/3/4) |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-propan-2-ylethane-1,2-diamine |
| InChI | InChI=1S/C25H30N6O2/c1-17(2)26-8-9-31(20-10-21(32-4)13-22(11-20)33-5)19-6-7-23-24(12-19)29-25(15-27-23)18-14-28-30(3)16-18/h6-7,10-17,26H,8-9H2,1-5H3 |
| InChIKey | OLAHOMJCDNXHFI-UHFFFAOYSA-N |
| SMILES | COC1=CC(OC)=CC(N(CCNC(C)C)C2=CC=C(N=CC(C3=CN(C)N=C3)=N4)C4=C2)=C1 |
| Reference | <br /> |
